About ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one
ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one (PubChem CID 142822980) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one |
| PubChem CID | 142822980 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one |
| SMILES | CC.CN1C(=O)CCCC1=O.CN1CCCCC1=O |
| InChI | InChI=1S/C6H9NO2.C6H11NO.C2H6/c1-7-5(8)3-2-4-6(7)9;1-7-5-3-2-4-6(7)8;1-2/h2-4H2,1H3;2-5H2,1H3;1-2H3 |
| InChIKey | WPGNWJOGOVVZGC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one?
The IUPAC name of ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one (CID 142822980) is ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one.
What is the SMILES notation for ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one?
The canonical SMILES for ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one is CC.CN1C(=O)CCCC1=O.CN1CCCCC1=O.
What is the InChIKey of ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one?
The InChIKey is WPGNWJOGOVVZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.C6H11NO.C2H6/c1-7-5(8)3-2-4-6(7)9;1-7-5-3-2-4-6(7)8;1-2/h2-4H2,1H3;2-5H2,1H3;1-2H3.
What are the key properties of ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one?
ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one has a molecular weight of 270.37 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpiperidine-2,6-dione;1-methylpiperidin-2-one is sourced from PubChem (CID 142822980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).