C16H31NO4 — CID 142822986
methyl 3-(cyclohexanecarbonylamino)-2-hydroxybutanoate;2-methylpropane (PubChem CID 142822986) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is methyl 3-(cyclohexanecarbonylamino)-2-hydroxybutanoate;2-methylpropane.
| Compound Name | methyl 3-(cyclohexanecarbonylamino)-2-hydroxybutanoate;2-methylpropane |
|---|---|
| PubChem CID | 142822986 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | methyl 3-(cyclohexanecarbonylamino)-2-hydroxybutanoate;2-methylpropane |
| SMILES | CC(C)C.COC(=O)C(O)C(C)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H21NO4.C4H10/c1-8(10(14)12(16)17-2)13-11(15)9-6-4-3-5-7-9;1-4(2)3/h8-10,14H,3-7H2,1-2H3,(H,13,15);4H,1-3H3 |
| InChIKey | KHFYIPPYRYOMMC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |