C28H22ClF6N5O2 — CID 142823213
(Z,5E)-2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-5-(3-chloro-4-pyridinyl)-5-hydroxyimino-4-(2-methylcyclopropylidene)-1-pyridin-4-ylpent-1-en-3-one (PubChem CID 142823213) has the molecular formula C28H22ClF6N5O2 and a molecular weight of 609.96 g/mol. Its IUPAC name is (Z,5E)-2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-5-(3-chloro-4-pyridinyl)-5-hydroxyimino-4-(2-methylcyclopropylidene)-1-pyridin-4-ylpent-1-en-3-one.
| Compound Name | (Z,5E)-2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-5-(3-chloro-4-pyridinyl)-5-hydroxyimino-4-(2-methylcyclopropylidene)-1-pyridin-4-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 142823213 |
| Molecular Formula | C28H22ClF6N5O2 |
| Molecular Weight | 609.96 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | (Z,5E)-2-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-5-(3-chloro-4-pyridinyl)-5-hydroxyimino-4-(2-methylcyclopropylidene)-1-pyridin-4-ylpent-1-en-3-one |
| SMILES | CC1CC1=C(C(=O)/C(N)=C(/NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccncc1)/C(=N\O)c1ccncc1Cl |
| InChI | InChI=1S/C28H22ClF6N5O2/c1-14-8-20(14)22(25(40-42)19-4-7-38-13-21(19)29)26(41)23(36)24(16-2-5-37-6-3-16)39-12-15-9-17(27(30,31)32)11-18(10-15)28(33,34)35/h2-7,9-11,13-14,39,42H,8,12,36H2,1H3/b22-20?,24-23-,40-25- |
| InChIKey | MVGSDNZQSHAXTL-OZFNWMJSSA-N |
| XLogP | 6.37 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|