C11H15F6NO — CID 142823318
(3E)-3-[(Z)-2-aminoethenyl]-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol;ethane (PubChem CID 142823318) has the molecular formula C11H15F6NO and a molecular weight of 291.24 g/mol. Its IUPAC name is (3E)-3-[(Z)-2-aminoethenyl]-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol;ethane.
| Compound Name | (3E)-3-[(Z)-2-aminoethenyl]-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol;ethane |
|---|---|
| PubChem CID | 142823318 |
| Molecular Formula | C11H15F6NO |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (3E)-3-[(Z)-2-aminoethenyl]-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol;ethane |
| SMILES | C=C/C=C(\C=C/N)C(O)(C(F)(F)F)C(F)(F)F.CC |
| InChI | InChI=1S/C9H9F6NO.C2H6/c1-2-3-6(4-5-16)7(17,8(10,11)12)9(13,14)15;1-2/h2-5,17H,1,16H2;1-2H3/b5-4-,6-3+; |
| InChIKey | MRQINZZQKWVPHM-OLEHIIJFSA-N |
| XLogP | 3.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|