About azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane
azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane (PubChem CID 142823970) has the molecular formula C15H21IN4O
and a molecular weight of 400.26 g/mol. Its IUPAC name is azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane.
Molecular Properties
| Compound Name | azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane |
| PubChem CID | 142823970 |
| Molecular Formula | C15H21IN4O |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane |
| SMILES | C=Cc1cnccc1/C(=C\C=C/C)I(C)ON=[N+]=[N-].CC |
| InChI | InChI=1S/C13H15IN4O.C2H6/c1-4-6-7-13(14(3)19-18-17-15)12-8-9-16-10-11(12)5-2;1-2/h4-10H,2H2,1,3H3;1-2H3/b6-4-,13-7+; |
| InChIKey | RCBSOBHKFMHYOI-ZJPWNLOHSA-N |
| XLogP | 5.96 |
| TPSA | 70.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane?
The IUPAC name of azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane (CID 142823970) is azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane.
What is the SMILES notation for azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane?
The canonical SMILES for azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane is C=Cc1cnccc1/C(=C\C=C/C)I(C)ON=[N+]=[N-].CC.
What is the InChIKey of azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane?
The InChIKey is RCBSOBHKFMHYOI-ZJPWNLOHSA-N. The full InChI is InChI=1S/C13H15IN4O.C2H6/c1-4-6-7-13(14(3)19-18-17-15)12-8-9-16-10-11(12)5-2;1-2/h4-10H,2H2,1,3H3;1-2H3/b6-4-,13-7+;.
What are the key properties of azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane?
azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane has a molecular weight of 400.26 g/mol, XLogP of 5.96, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azidooxy-[(1E,3Z)-1-(3-ethenyl-4-pyridinyl)penta-1,3-dienyl]-methyl-λ3-iodane;ethane is sourced from PubChem (CID 142823970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).