C20H34N4O — CID 142824256
ethane;2-[(Z)-ethylideneamino]-4-methyl-3-prop-1-en-2-yl-1H-pyrido[2,3-e][1,4]diazepin-5-one (PubChem CID 142824256) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is ethane;2-[(Z)-ethylideneamino]-4-methyl-3-prop-1-en-2-yl-1H-pyrido[2,3-e][1,4]diazepin-5-one.
| Compound Name | ethane;2-[(Z)-ethylideneamino]-4-methyl-3-prop-1-en-2-yl-1H-pyrido[2,3-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 142824256 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | ethane;2-[(Z)-ethylideneamino]-4-methyl-3-prop-1-en-2-yl-1H-pyrido[2,3-e][1,4]diazepin-5-one |
| SMILES | C=C(C)C1=C(/N=C\C)Nc2ncccc2C(=O)N1C.CC.CC.CC |
| InChI | InChI=1S/C14H16N4O.3C2H6/c1-5-15-13-11(9(2)3)18(4)14(19)10-7-6-8-16-12(10)17-13;3*1-2/h5-8H,2H2,1,3-4H3,(H,16,17);3*1-2H3/b15-5-;;; |
| InChIKey | BNTHLYJLFHVBAT-YIYSYREMSA-N |
| XLogP | 5.49 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|