About 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide
4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide (PubChem CID 142824963) has the molecular formula C18H26F3N5O3S
and a molecular weight of 449.50 g/mol. Its IUPAC name is 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide |
| PubChem CID | 142824963 |
| Molecular Formula | C18H26F3N5O3S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide |
| SMILES | NC(=O)C1(S(=O)N2CCN(c3cnc(CCCC(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C18H26F3N5O3S/c19-18(20,21)3-1-2-14-12-24-15(13-23-14)25-6-8-26(9-7-25)30(28)17(16(22)27)4-10-29-11-5-17/h12-13H,1-11H2,(H2,22,27) |
| InChIKey | JXRQCXCNHNJJLW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide?
The IUPAC name of 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide (CID 142824963) is 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide.
What is the SMILES notation for 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide?
The canonical SMILES for 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide is NC(=O)C1(S(=O)N2CCN(c3cnc(CCCC(F)(F)F)cn3)CC2)CCOCC1.
What is the InChIKey of 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide?
The InChIKey is JXRQCXCNHNJJLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F3N5O3S/c19-18(20,21)3-1-2-14-12-24-15(13-23-14)25-6-8-26(9-7-25)30(28)17(16(22)27)4-10-29-11-5-17/h12-13H,1-11H2,(H2,22,27).
What are the key properties of 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide?
4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide has a molecular weight of 449.50 g/mol, XLogP of 1.18, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfinyloxane-4-carboxamide is sourced from PubChem (CID 142824963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).