C23H29FN4O3 — CID 142824990
4-[[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]oxy-methylamino]oxane-4-carboxamide (PubChem CID 142824990) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is 4-[[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]oxy-methylamino]oxane-4-carboxamide.
| Compound Name | 4-[[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]oxy-methylamino]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142824990 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-[[4-[4-(4-fluorophenyl)phenyl]piperazin-1-yl]oxy-methylamino]oxane-4-carboxamide |
| SMILES | CN(ON1CCN(c2ccc(-c3ccc(F)cc3)cc2)CC1)C1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C23H29FN4O3/c1-26(23(22(25)29)10-16-30-17-11-23)31-28-14-12-27(13-15-28)21-8-4-19(5-9-21)18-2-6-20(24)7-3-18/h2-9H,10-17H2,1H3,(H2,25,29) |
| InChIKey | QFBSRMANLWLNFU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|