C23H37N3O2 — CID 142825209
4-[1-[4-(4-butan-2-yl-3-methylphenyl)piperazin-1-yl]ethyl]oxane-4-carboxamide (PubChem CID 142825209) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 4-[1-[4-(4-butan-2-yl-3-methylphenyl)piperazin-1-yl]ethyl]oxane-4-carboxamide.
| Compound Name | 4-[1-[4-(4-butan-2-yl-3-methylphenyl)piperazin-1-yl]ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142825209 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 4-[1-[4-(4-butan-2-yl-3-methylphenyl)piperazin-1-yl]ethyl]oxane-4-carboxamide |
| SMILES | CCC(C)c1ccc(N2CCN(C(C)C3(C(N)=O)CCOCC3)CC2)cc1C |
| InChI | InChI=1S/C23H37N3O2/c1-5-17(2)21-7-6-20(16-18(21)3)26-12-10-25(11-13-26)19(4)23(22(24)27)8-14-28-15-9-23/h6-7,16-17,19H,5,8-15H2,1-4H3,(H2,24,27) |
| InChIKey | LYGYMFQYACVGLB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|