C26H38N4O4S — CID 142825276
4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 142825276) has the molecular formula C26H38N4O4S and a molecular weight of 502.68 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142825276 |
| Molecular Formula | C26H38N4O4S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(C2CCN(S(=O)(=O)C3(C(N)=O)CCN(Cc4ccc[nH]4)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H38N4O4S/c1-2-3-19-34-24-8-6-21(7-9-24)22-10-15-30(16-11-22)35(32,33)26(25(27)31)12-17-29(18-13-26)20-23-5-4-14-28-23/h4-9,14,22,28H,2-3,10-13,15-20H2,1H3,(H2,27,31) |
| InChIKey | WSFMZQQDMRCCKO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|