C9H13F2N — CID 142825285
(2E,4Z)-2-ethenyl-4,5-difluoro-N-methylhexa-2,4-dien-1-amine (PubChem CID 142825285) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-4,5-difluoro-N-methylhexa-2,4-dien-1-amine.
| Compound Name | (2E,4Z)-2-ethenyl-4,5-difluoro-N-methylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142825285 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (2E,4Z)-2-ethenyl-4,5-difluoro-N-methylhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C(F)=C(/C)F)CNC |
| InChI | InChI=1S/C9H13F2N/c1-4-8(6-12-3)5-9(11)7(2)10/h4-5,12H,1,6H2,2-3H3/b8-5+,9-7- |
| InChIKey | NHZANYPSRLUVQJ-KCGQVOQMSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|