C34H40ClN3O2 — CID 142825474
N-[3-(2-chlorophenyl)propyl]-1-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 142825474) has the molecular formula C34H40ClN3O2 and a molecular weight of 558.17 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-1-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-1-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 142825474 |
| Molecular Formula | C34H40ClN3O2 |
| Molecular Weight | 558.17 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-1-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | Cc1cc(C)c(C)c(OCCc2ccc(C34CC=C(C(=O)NCCCc5ccccc5Cl)C(CNC3)N4)cc2)c1 |
| InChI | InChI=1S/C34H40ClN3O2/c1-23-19-24(2)25(3)32(20-23)40-18-15-26-10-12-28(13-11-26)34-16-14-29(31(38-34)21-36-22-34)33(39)37-17-6-8-27-7-4-5-9-30(27)35/h4-5,7,9-14,19-20,31,36,38H,6,8,15-18,21-22H2,1-3H3,(H,37,39) |
| InChIKey | NNEYMPSILJXXOC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.17 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|