About 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine
1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine (PubChem CID 142825646) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine |
| PubChem CID | 142825646 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CC=CO1 |
| InChI | InChI=1S/C7H13NO/c1-8(2)6-7-4-3-5-9-7/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | JBFMAXUVSWCKMB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine (CID 142825646) is 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine is CN(C)CC1CC=CO1.
What is the InChIKey of 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine?
The InChIKey is JBFMAXUVSWCKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-8(2)6-7-4-3-5-9-7/h3,5,7H,4,6H2,1-2H3.
What are the key properties of 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine?
1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine has a molecular weight of 127.19 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydrofuran-2-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 142825646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).