About ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol
ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol (PubChem CID 142825834) has the molecular formula C21H27NO4S
and a molecular weight of 389.52 g/mol. Its IUPAC name is ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol.
Molecular Properties
| Compound Name | ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol |
| PubChem CID | 142825834 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol |
| SMILES | CC.Cc1ccc2cccc(O)c2n1.Cc1cccc(S(=O)(=O)CCO)c1 |
| InChI | InChI=1S/C10H9NO.C9H12O3S.C2H6/c1-7-5-6-8-3-2-4-9(12)10(8)11-7;1-8-3-2-4-9(7-8)13(11,12)6-5-10;1-2/h2-6,12H,1H3;2-4,7,10H,5-6H2,1H3;1-2H3 |
| InChIKey | KVOICJCRWSVDCC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol?
The IUPAC name of ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol (CID 142825834) is ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol.
What is the SMILES notation for ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol?
The canonical SMILES for ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol is CC.Cc1ccc2cccc(O)c2n1.Cc1cccc(S(=O)(=O)CCO)c1.
What is the InChIKey of ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol?
The InChIKey is KVOICJCRWSVDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C9H12O3S.C2H6/c1-7-5-6-8-3-2-4-9(12)10(8)11-7;1-8-3-2-4-9(7-8)13(11,12)6-5-10;1-2/h2-6,12H,1H3;2-4,7,10H,5-6H2,1H3;1-2H3.
What are the key properties of ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol?
ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol has a molecular weight of 389.52 g/mol, XLogP of 4.04, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(3-methylphenyl)sulfonylethanol;2-methylquinolin-8-ol is sourced from PubChem (CID 142825834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).