C18H20N2O2 — CID 142825866
6-ethyl-1H-indazole;6-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 142825866) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 6-ethyl-1H-indazole;6-methyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-ethyl-1H-indazole;6-methyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 142825866 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 6-ethyl-1H-indazole;6-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCc1ccc2cn[nH]c2c1.Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H10N2.C9H10O2/c1-2-7-3-4-8-6-10-11-9(8)5-7;1-7-2-3-8-9(6-7)11-5-4-10-8/h3-6H,2H2,1H3,(H,10,11);2-3,6H,4-5H2,1H3 |
| InChIKey | ZYXLJZDSFXDQBX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |