About 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol
1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol (PubChem CID 142825914) has the molecular formula C19H18O
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol.
Molecular Properties
| Compound Name | 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol |
| PubChem CID | 142825914 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol |
| SMILES | C=C1Cc2ccc(O)cc2C12CC(C)c1ccccc12 |
| InChI | InChI=1S/C19H18O/c1-12-11-19(17-6-4-3-5-16(12)17)13(2)9-14-7-8-15(20)10-18(14)19/h3-8,10,12,20H,2,9,11H2,1H3 |
| InChIKey | FEXKPPJKEQKAFY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol?
The IUPAC name of 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol (CID 142825914) is 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol.
What is the SMILES notation for 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol?
The canonical SMILES for 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol is C=C1Cc2ccc(O)cc2C12CC(C)c1ccccc12.
What is the InChIKey of 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol?
The InChIKey is FEXKPPJKEQKAFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O/c1-12-11-19(17-6-4-3-5-16(12)17)13(2)9-14-7-8-15(20)10-18(14)19/h3-8,10,12,20H,2,9,11H2,1H3.
What are the key properties of 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol?
1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol has a molecular weight of 262.35 g/mol, XLogP of 4.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2'-methylidenespiro[1,2-dihydroindene-3,3'-1H-indene]-5'-ol is sourced from PubChem (CID 142825914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).