C20H27N3O — CID 142826020
1-[(3-aminophenyl)methyl]-3,5-dihydro-2,3-benzodiazepin-4-one;ethane (PubChem CID 142826020) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-3,5-dihydro-2,3-benzodiazepin-4-one;ethane.
| Compound Name | 1-[(3-aminophenyl)methyl]-3,5-dihydro-2,3-benzodiazepin-4-one;ethane |
|---|---|
| PubChem CID | 142826020 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-3,5-dihydro-2,3-benzodiazepin-4-one;ethane |
| SMILES | CC.CC.Nc1cccc(CC2=NNC(=O)Cc3ccccc32)c1 |
| InChI | InChI=1S/C16H15N3O.2C2H6/c17-13-6-3-4-11(8-13)9-15-14-7-2-1-5-12(14)10-16(20)19-18-15;2*1-2/h1-8H,9-10,17H2,(H,19,20);2*1-2H3 |
| InChIKey | WDIQITDIOHJPNF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|