C24H29F6N3O2 — CID 142826461
[(1S,3R)-3-[methyl(oxan-4-yl)amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclopentyl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 142826461) has the molecular formula C24H29F6N3O2 and a molecular weight of 505.50 g/mol. Its IUPAC name is [(1S,3R)-3-[methyl(oxan-4-yl)amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclopentyl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(1S,3R)-3-[methyl(oxan-4-yl)amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclopentyl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 142826461 |
| Molecular Formula | C24H29F6N3O2 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [(1S,3R)-3-[methyl(oxan-4-yl)amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclopentyl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | C=C(C(F)(F)F)[C@]1(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)CC[C@@H](N(C)C2CCOCC2)C1 |
| InChI | InChI=1S/C24H29F6N3O2/c1-15(23(25,26)27)22(7-3-19(12-22)32(2)18-5-9-35-10-6-18)21(34)33-8-4-20-16(14-33)11-17(13-31-20)24(28,29)30/h11,13,18-19H,1,3-10,12,14H2,2H3/t19-,22+/m1/s1 |
| InChIKey | SVUPRRZZEXTKKQ-KNQAVFIVSA-N |
| XLogP | 4.75 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|