About 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane
3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane (PubChem CID 142826800) has the molecular formula C17H28F3NO3
and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane.
Molecular Properties
| Compound Name | 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane |
| PubChem CID | 142826800 |
| Molecular Formula | C17H28F3NO3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane |
| SMILES | CCC.O=C(O)C1CCC(N(C(=O)C(F)(F)F)C2CCCCC2)C1 |
| InChI | InChI=1S/C14H20F3NO3.C3H8/c15-14(16,17)13(21)18(10-4-2-1-3-5-10)11-7-6-9(8-11)12(19)20;1-3-2/h9-11H,1-8H2,(H,19,20);3H2,1-2H3 |
| InChIKey | XCIHCRHXTLOZTK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane?
The IUPAC name of 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane (CID 142826800) is 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane.
What is the SMILES notation for 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane?
The canonical SMILES for 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane is CCC.O=C(O)C1CCC(N(C(=O)C(F)(F)F)C2CCCCC2)C1.
What is the InChIKey of 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane?
The InChIKey is XCIHCRHXTLOZTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F3NO3.C3H8/c15-14(16,17)13(21)18(10-4-2-1-3-5-10)11-7-6-9(8-11)12(19)20;1-3-2/h9-11H,1-8H2,(H,19,20);3H2,1-2H3.
What are the key properties of 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane?
3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane has a molecular weight of 351.41 g/mol, XLogP of 4.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]cyclopentane-1-carboxylic acid;propane is sourced from PubChem (CID 142826800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).