C16H24O2 — CID 142826813
ethane;methyl 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclopent-3-ene-1-carboxylate (PubChem CID 142826813) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is ethane;methyl 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclopent-3-ene-1-carboxylate.
| Compound Name | ethane;methyl 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 142826813 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | ethane;methyl 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclopent-3-ene-1-carboxylate |
| SMILES | C=C/C=C(\C=C/C)C1(C(=O)OC)CC=CC1.CC |
| InChI | InChI=1S/C14H18O2.C2H6/c1-4-8-12(9-5-2)14(13(15)16-3)10-6-7-11-14;1-2/h4-9H,1,10-11H2,2-3H3;1-2H3/b9-5-,12-8+; |
| InChIKey | CINGPWKUPBECQC-QBZUAKEHSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|