C16H18N4O2 — CID 142827331
[3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane (PubChem CID 142827331) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane.
| Compound Name | [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane |
|---|---|
| PubChem CID | 142827331 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane |
| SMILES | CC.Nc1ncc(-c2cccc(CO)c2)nc1-c1cnco1 |
| InChI | InChI=1S/C14H12N4O2.C2H6/c15-14-13(12-6-16-8-20-12)18-11(5-17-14)10-3-1-2-9(4-10)7-19;1-2/h1-6,8,19H,7H2,(H2,15,17);1-2H3 |
| InChIKey | UTBWBXRSWACJAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |