About [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane
[3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane (PubChem CID 142827331) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane.
Molecular Properties
| Compound Name | [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane |
| PubChem CID | 142827331 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane |
| SMILES | CC.Nc1ncc(-c2cccc(CO)c2)nc1-c1cnco1 |
| InChI | InChI=1S/C14H12N4O2.C2H6/c15-14-13(12-6-16-8-20-12)18-11(5-17-14)10-3-1-2-9(4-10)7-19;1-2/h1-6,8,19H,7H2,(H2,15,17);1-2H3 |
| InChIKey | UTBWBXRSWACJAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane?
The IUPAC name of [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane (CID 142827331) is [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane.
What is the SMILES notation for [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane?
The canonical SMILES for [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane is CC.Nc1ncc(-c2cccc(CO)c2)nc1-c1cnco1.
What is the InChIKey of [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane?
The InChIKey is UTBWBXRSWACJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2.C2H6/c15-14-13(12-6-16-8-20-12)18-11(5-17-14)10-3-1-2-9(4-10)7-19;1-2/h1-6,8,19H,7H2,(H2,15,17);1-2H3.
What are the key properties of [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane?
[3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane has a molecular weight of 298.35 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-amino-6-(1,3-oxazol-5-yl)pyrazin-2-yl]phenyl]methanol;ethane is sourced from PubChem (CID 142827331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).