About 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine
1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine (PubChem CID 142827647) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine.
Molecular Properties
| Compound Name | 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine |
| PubChem CID | 142827647 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine |
| SMILES | C=CC1=C(C(=C)N)CC(OCC)=CC1 |
| InChI | InChI=1S/C12H17NO/c1-4-10-6-7-11(14-5-2)8-12(10)9(3)13/h4,7H,1,3,5-6,8,13H2,2H3 |
| InChIKey | YBNVYJCEGNHUJL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine?
The IUPAC name of 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine (CID 142827647) is 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine.
What is the SMILES notation for 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine?
The canonical SMILES for 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine is C=CC1=C(C(=C)N)CC(OCC)=CC1.
What is the InChIKey of 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine?
The InChIKey is YBNVYJCEGNHUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-4-10-6-7-11(14-5-2)8-12(10)9(3)13/h4,7H,1,3,5-6,8,13H2,2H3.
What are the key properties of 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine?
1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine has a molecular weight of 191.27 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethenyl-5-ethoxycyclohexa-1,4-dien-1-yl)ethenamine is sourced from PubChem (CID 142827647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).