C13H9ClO4 — CID 142828273
(3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (PubChem CID 142828273) has the molecular formula C13H9ClO4 and a molecular weight of 264.66 g/mol. Its IUPAC name is (3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione.
| Compound Name | (3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 142828273 |
| Molecular Formula | C13H9ClO4 |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | (3Z,3aR,6aR)-3-[(3-chlorophenyl)methylidene]-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| SMILES | O=C1O[C@H]2C(=O)OC[C@H]2/C1=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9ClO4/c14-8-3-1-2-7(4-8)5-9-10-6-17-13(16)11(10)18-12(9)15/h1-5,10-11H,6H2/b9-5-/t10-,11+/m0/s1 |
| InChIKey | NDIWEUYNXUPPKB-DESOLJLISA-N |
| XLogP | 1.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|