C22H31ClO4 — CID 142828276
(2R,3S,4Z)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-oxooxolane-2-carboxylic acid;nonane (PubChem CID 142828276) has the molecular formula C22H31ClO4 and a molecular weight of 394.94 g/mol. Its IUPAC name is (2R,3S,4Z)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-oxooxolane-2-carboxylic acid;nonane.
| Compound Name | (2R,3S,4Z)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-oxooxolane-2-carboxylic acid;nonane |
|---|---|
| PubChem CID | 142828276 |
| Molecular Formula | C22H31ClO4 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2R,3S,4Z)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-oxooxolane-2-carboxylic acid;nonane |
| SMILES | CCCCCCCCC.C[C@H]1/C(=C/c2ccc(Cl)cc2)C(=O)O[C@H]1C(=O)O |
| InChI | InChI=1S/C13H11ClO4.C9H20/c1-7-10(13(17)18-11(7)12(15)16)6-8-2-4-9(14)5-3-8;1-3-5-7-9-8-6-4-2/h2-7,11H,1H3,(H,15,16);3-9H2,1-2H3/b10-6-;/t7-,11+;/m0./s1 |
| InChIKey | QFDWDHMRMYYAOT-CPRUUFQSSA-N |
| XLogP | 6.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|