About (Z)-N-ethylhex-3-en-2-imine;prop-1-yne
(Z)-N-ethylhex-3-en-2-imine;prop-1-yne (PubChem CID 142828309) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (Z)-N-ethylhex-3-en-2-imine;prop-1-yne.
Molecular Properties
| Compound Name | (Z)-N-ethylhex-3-en-2-imine;prop-1-yne |
| PubChem CID | 142828309 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (Z)-N-ethylhex-3-en-2-imine;prop-1-yne |
| SMILES | C#CC.CC/C=C\C(C)=N\CC |
| InChI | InChI=1S/C8H15N.C3H4/c1-4-6-7-8(3)9-5-2;1-3-2/h6-7H,4-5H2,1-3H3;1H,2H3/b7-6-,9-8+; |
| InChIKey | HNFXMNYSBYZVEP-FTOWGUJXSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethylhex-3-en-2-imine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethylhex-3-en-2-imine;prop-1-yne?
The IUPAC name of (Z)-N-ethylhex-3-en-2-imine;prop-1-yne (CID 142828309) is (Z)-N-ethylhex-3-en-2-imine;prop-1-yne.
What is the SMILES notation for (Z)-N-ethylhex-3-en-2-imine;prop-1-yne?
The canonical SMILES for (Z)-N-ethylhex-3-en-2-imine;prop-1-yne is C#CC.CC/C=C\C(C)=N\CC.
What is the InChIKey of (Z)-N-ethylhex-3-en-2-imine;prop-1-yne?
The InChIKey is HNFXMNYSBYZVEP-FTOWGUJXSA-N. The full InChI is InChI=1S/C8H15N.C3H4/c1-4-6-7-8(3)9-5-2;1-3-2/h6-7H,4-5H2,1-3H3;1H,2H3/b7-6-,9-8+;.
What are the key properties of (Z)-N-ethylhex-3-en-2-imine;prop-1-yne?
(Z)-N-ethylhex-3-en-2-imine;prop-1-yne has a molecular weight of 165.28 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethylhex-3-en-2-imine;prop-1-yne is sourced from PubChem (CID 142828309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).