C22H35NO2 — CID 142828358
ethane;1-ethyl-4-methoxybenzene;2-(3-methoxy-4-methylphenyl)-N-methylethanamine (PubChem CID 142828358) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is ethane;1-ethyl-4-methoxybenzene;2-(3-methoxy-4-methylphenyl)-N-methylethanamine.
| Compound Name | ethane;1-ethyl-4-methoxybenzene;2-(3-methoxy-4-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 142828358 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | ethane;1-ethyl-4-methoxybenzene;2-(3-methoxy-4-methylphenyl)-N-methylethanamine |
| SMILES | CC.CCc1ccc(OC)cc1.CNCCc1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C11H17NO.C9H12O.C2H6/c1-9-4-5-10(6-7-12-2)8-11(9)13-3;1-3-8-4-6-9(10-2)7-5-8;1-2/h4-5,8,12H,6-7H2,1-3H3;4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | OUKKJGRYWNXXAT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |