C20H19NO — CID 142828365
(1S)-1-(naphthalen-1-ylmethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 142828365) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (1S)-1-(naphthalen-1-ylmethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | (1S)-1-(naphthalen-1-ylmethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 142828365 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (1S)-1-(naphthalen-1-ylmethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | Oc1ccc2c(c1)[C@H](Cc1cccc3ccccc13)NCC2 |
| InChI | InChI=1S/C20H19NO/c22-17-9-8-15-10-11-21-20(19(15)13-17)12-16-6-3-5-14-4-1-2-7-18(14)16/h1-9,13,20-22H,10-12H2/t20-/m0/s1 |
| InChIKey | DPSXGYXHKPCNKP-FQEVSTJZSA-N |
| XLogP | 3.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |