C14H21NO2 — CID 142828646
(2E,4E,7Z)-2,5-dimethyl-6-methylidene-8-(methylideneamino)octa-2,4,7-trienoic acid;ethane (PubChem CID 142828646) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2E,4E,7Z)-2,5-dimethyl-6-methylidene-8-(methylideneamino)octa-2,4,7-trienoic acid;ethane.
| Compound Name | (2E,4E,7Z)-2,5-dimethyl-6-methylidene-8-(methylideneamino)octa-2,4,7-trienoic acid;ethane |
|---|---|
| PubChem CID | 142828646 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (2E,4E,7Z)-2,5-dimethyl-6-methylidene-8-(methylideneamino)octa-2,4,7-trienoic acid;ethane |
| SMILES | C=N/C=C\C(=C)/C(C)=C/C=C(\C)C(=O)O.CC |
| InChI | InChI=1S/C12H15NO2.C2H6/c1-9(10(2)7-8-13-4)5-6-11(3)12(14)15;1-2/h5-8H,2,4H2,1,3H3,(H,14,15);1-2H3/b8-7-,9-5+,11-6+; |
| InChIKey | YGDATLAHSHHCMJ-ZKODRIDZSA-N |
| XLogP | 3.76 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|