About 1-methoxy-2-methylbutane;3-methylheptane
1-methoxy-2-methylbutane;3-methylheptane (PubChem CID 142829419) has the molecular formula C14H32O
and a molecular weight of 216.41 g/mol. Its IUPAC name is 1-methoxy-2-methylbutane;3-methylheptane.
Molecular Properties
| Compound Name | 1-methoxy-2-methylbutane;3-methylheptane |
| PubChem CID | 142829419 |
| Molecular Formula | C14H32O |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.25 |
| IUPAC Name | 1-methoxy-2-methylbutane;3-methylheptane |
| SMILES | CCC(C)COC.CCCCC(C)CC |
| InChI | InChI=1S/C8H18.C6H14O/c1-4-6-7-8(3)5-2;1-4-6(2)5-7-3/h8H,4-7H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | SLVCGBMLIUWJIR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-2-methylbutane;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-methylbutane;3-methylheptane?
The IUPAC name of 1-methoxy-2-methylbutane;3-methylheptane (CID 142829419) is 1-methoxy-2-methylbutane;3-methylheptane.
What is the SMILES notation for 1-methoxy-2-methylbutane;3-methylheptane?
The canonical SMILES for 1-methoxy-2-methylbutane;3-methylheptane is CCC(C)COC.CCCCC(C)CC.
What is the InChIKey of 1-methoxy-2-methylbutane;3-methylheptane?
The InChIKey is SLVCGBMLIUWJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C6H14O/c1-4-6-7-8(3)5-2;1-4-6(2)5-7-3/h8H,4-7H2,1-3H3;6H,4-5H2,1-3H3.
What are the key properties of 1-methoxy-2-methylbutane;3-methylheptane?
1-methoxy-2-methylbutane;3-methylheptane has a molecular weight of 216.41 g/mol, XLogP of 4.90, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-methylbutane;3-methylheptane is sourced from PubChem (CID 142829419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).