About (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one
(6E)-1,4-dimethyl-6-propylidenepiperidin-2-one (PubChem CID 142829757) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one.
Molecular Properties
| Compound Name | (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one |
| PubChem CID | 142829757 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one |
| SMILES | CC/C=C1\CC(C)CC(=O)N1C |
| InChI | InChI=1S/C10H17NO/c1-4-5-9-6-8(2)7-10(12)11(9)3/h5,8H,4,6-7H2,1-3H3/b9-5+ |
| InChIKey | KYOSLOFCTPMSDU-WEVVVXLNSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one?
The IUPAC name of (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one (CID 142829757) is (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one.
What is the SMILES notation for (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one?
The canonical SMILES for (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one is CC/C=C1\CC(C)CC(=O)N1C.
What is the InChIKey of (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one?
The InChIKey is KYOSLOFCTPMSDU-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-5-9-6-8(2)7-10(12)11(9)3/h5,8H,4,6-7H2,1-3H3/b9-5+.
What are the key properties of (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one?
(6E)-1,4-dimethyl-6-propylidenepiperidin-2-one has a molecular weight of 167.25 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-1,4-dimethyl-6-propylidenepiperidin-2-one is sourced from PubChem (CID 142829757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).