About cyclohexanecarboxamide
cyclohexanecarboxamide (PubChem CID 14283) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is cyclohexanecarboxamide.
Molecular Properties
| Compound Name | cyclohexanecarboxamide |
| PubChem CID | 14283 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | cyclohexanecarboxamide |
| SMILES | NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C7H13NO/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H2,8,9) |
| InChIKey | PNZXMIKHJXIPEK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarboxamide?
The IUPAC name of cyclohexanecarboxamide (CID 14283) is cyclohexanecarboxamide.
What is the SMILES notation for cyclohexanecarboxamide?
The canonical SMILES for cyclohexanecarboxamide is NC(=O)C1CCCCC1.
What is the InChIKey of cyclohexanecarboxamide?
The InChIKey is PNZXMIKHJXIPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H2,8,9).
What are the key properties of cyclohexanecarboxamide?
cyclohexanecarboxamide has a molecular weight of 127.19 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarboxamide is sourced from PubChem (CID 14283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).