C12H14FNO — CID 142830341
2-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-3-methyl-1,2-dihydropyrrol-5-one (PubChem CID 142830341) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-3-methyl-1,2-dihydropyrrol-5-one.
| Compound Name | 2-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-3-methyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 142830341 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]-3-methyl-1,2-dihydropyrrol-5-one |
| SMILES | C=C/C(=C(F)\C=C/C)C1NC(=O)C=C1C |
| InChI | InChI=1S/C12H14FNO/c1-4-6-10(13)9(5-2)12-8(3)7-11(15)14-12/h4-7,12H,2H2,1,3H3,(H,14,15)/b6-4-,10-9- |
| InChIKey | PQBILRPSAHRINO-DRBYQGIJSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|