About cycloheptylmethyl carbamimidothioate
cycloheptylmethyl carbamimidothioate (PubChem CID 142830431) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is cycloheptylmethyl carbamimidothioate.
Molecular Properties
| Compound Name | cycloheptylmethyl carbamimidothioate |
| PubChem CID | 142830431 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | cycloheptylmethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC1CCCCCC1 |
| InChI | InChI=1S/C9H18N2S/c10-9(11)12-7-8-5-3-1-2-4-6-8/h8H,1-7H2,(H3,10,11) |
| InChIKey | QWEDRMXJPABYDV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cycloheptylmethyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptylmethyl carbamimidothioate?
The IUPAC name of cycloheptylmethyl carbamimidothioate (CID 142830431) is cycloheptylmethyl carbamimidothioate.
What is the SMILES notation for cycloheptylmethyl carbamimidothioate?
The canonical SMILES for cycloheptylmethyl carbamimidothioate is [H]/N=C(\N)SCC1CCCCCC1.
What is the InChIKey of cycloheptylmethyl carbamimidothioate?
The InChIKey is QWEDRMXJPABYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c10-9(11)12-7-8-5-3-1-2-4-6-8/h8H,1-7H2,(H3,10,11).
What are the key properties of cycloheptylmethyl carbamimidothioate?
cycloheptylmethyl carbamimidothioate has a molecular weight of 186.32 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptylmethyl carbamimidothioate is sourced from PubChem (CID 142830431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).