C7H9FS — CID 142830684
(3E,5E)-6-fluorohepta-1,3,5-triene-3-thiol (PubChem CID 142830684) has the molecular formula C7H9FS and a molecular weight of 144.21 g/mol. Its IUPAC name is (3E,5E)-6-fluorohepta-1,3,5-triene-3-thiol.
| Compound Name | (3E,5E)-6-fluorohepta-1,3,5-triene-3-thiol |
|---|---|
| PubChem CID | 142830684 |
| Molecular Formula | C7H9FS |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3E,5E)-6-fluorohepta-1,3,5-triene-3-thiol |
| SMILES | C=C/C(S)=C\C=C(/C)F |
| InChI | InChI=1S/C7H9FS/c1-3-7(9)5-4-6(2)8/h3-5,9H,1H2,2H3/b6-4+,7-5+ |
| InChIKey | VYMDTNFSEBPUBA-YDFGWWAZSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|