C24H19N4P — CID 142830757
2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethanimine (PubChem CID 142830757) has the molecular formula C24H19N4P and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethanimine.
| Compound Name | 2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethanimine |
|---|---|
| PubChem CID | 142830757 |
| Molecular Formula | C24H19N4P |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[2-(8-phenylimidazo[4,5-c]quinolin-1-yl)phenyl]-1-phosphanylethanimine |
| SMILES | [H]/N=C(\P)Cc1ccccc1-n1cnc2cnc3ccc(-c4ccccc4)cc3c21 |
| InChI | InChI=1S/C24H19N4P/c25-23(29)13-18-8-4-5-9-22(18)28-15-27-21-14-26-20-11-10-17(12-19(20)24(21)28)16-6-2-1-3-7-16/h1-12,14-15,25H,13,29H2/b25-23- |
| InChIKey | MHMAMAJGYYKHFW-BZZOAKBMSA-N |
| XLogP | 5.64 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|