C20H35NO2 — CID 142830812
tert-butyl (2R)-1-(3,3,4,4-tetramethylhepta-1,6-dien-2-yl)pyrrolidine-2-carboxylate (PubChem CID 142830812) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is tert-butyl (2R)-1-(3,3,4,4-tetramethylhepta-1,6-dien-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(3,3,4,4-tetramethylhepta-1,6-dien-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142830812 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | tert-butyl (2R)-1-(3,3,4,4-tetramethylhepta-1,6-dien-2-yl)pyrrolidine-2-carboxylate |
| SMILES | C=CCC(C)(C)C(C)(C)C(=C)N1CCC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO2/c1-10-13-19(6,7)20(8,9)15(2)21-14-11-12-16(21)17(22)23-18(3,4)5/h10,16H,1-2,11-14H2,3-9H3/t16-/m1/s1 |
| InChIKey | AKIHGPZUJMIJGX-MRXNPFEDSA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|