C11H14N2O2S — CID 142831004
methyl (NE,1Z)-N-[(4-hydroxyphenyl)methylidene]-2-methylsulfanylethanehydrazonate (PubChem CID 142831004) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl (NE,1Z)-N-[(4-hydroxyphenyl)methylidene]-2-methylsulfanylethanehydrazonate.
| Compound Name | methyl (NE,1Z)-N-[(4-hydroxyphenyl)methylidene]-2-methylsulfanylethanehydrazonate |
|---|---|
| PubChem CID | 142831004 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl (NE,1Z)-N-[(4-hydroxyphenyl)methylidene]-2-methylsulfanylethanehydrazonate |
| SMILES | CO/C(CSC)=N\N=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N2O2S/c1-15-11(8-16-2)13-12-7-9-3-5-10(14)6-4-9/h3-7,14H,8H2,1-2H3/b12-7+,13-11- |
| InChIKey | LIBJJPIPKRUGEK-MHUJIAIDSA-N |
| XLogP | 2.13 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|