C12H20OS — CID 142831171
(4E,7Z)-4-(2-methylsulfanylethoxy)nona-1,4,7-triene (PubChem CID 142831171) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is (4E,7Z)-4-(2-methylsulfanylethoxy)nona-1,4,7-triene.
| Compound Name | (4E,7Z)-4-(2-methylsulfanylethoxy)nona-1,4,7-triene |
|---|---|
| PubChem CID | 142831171 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (4E,7Z)-4-(2-methylsulfanylethoxy)nona-1,4,7-triene |
| SMILES | C=CC/C(=C\C/C=C\C)OCCSC |
| InChI | InChI=1S/C12H20OS/c1-4-6-7-9-12(8-5-2)13-10-11-14-3/h4-6,9H,2,7-8,10-11H2,1,3H3/b6-4-,12-9+ |
| InChIKey | VAJZJCUDRHIHIQ-YWYLEKLXSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|