About (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene
(3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene (PubChem CID 14283122) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene.
Molecular Properties
| Compound Name | (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene |
| PubChem CID | 14283122 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene |
| SMILES | C=CCC[C@H](CC(OC)OC)C(=C)C |
| InChI | InChI=1S/C12H22O2/c1-6-7-8-11(10(2)3)9-12(13-4)14-5/h6,11-12H,1-2,7-9H2,3-5H3/t11-/m1/s1 |
| InChIKey | MUKSYFCMLRBNGO-LLVKDONJSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene?
The IUPAC name of (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene (CID 14283122) is (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene.
What is the SMILES notation for (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene?
The canonical SMILES for (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene is C=CCC[C@H](CC(OC)OC)C(=C)C.
What is the InChIKey of (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene?
The InChIKey is MUKSYFCMLRBNGO-LLVKDONJSA-N. The full InChI is InChI=1S/C12H22O2/c1-6-7-8-11(10(2)3)9-12(13-4)14-5/h6,11-12H,1-2,7-9H2,3-5H3/t11-/m1/s1.
What are the key properties of (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene?
(3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene has a molecular weight of 198.31 g/mol, XLogP of 3.15, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2,2-dimethoxyethyl)-2-methylhepta-1,6-diene is sourced from PubChem (CID 14283122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).