C36H33BrO4S2 — CID 142831685
4-(4-bromophenyl)sulfanyl-3-[[4-[(2E,4Z)-4,5-dimethylhepta-2,4,6-trien-2-yl]sulfanyl-5-methyl-2-oxo-6-[(1Z,3Z)-penta-1,3-dienyl]pyran-3-yl]methyl]chromen-2-one (PubChem CID 142831685) has the molecular formula C36H33BrO4S2 and a molecular weight of 673.69 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanyl-3-[[4-[(2E,4Z)-4,5-dimethylhepta-2,4,6-trien-2-yl]sulfanyl-5-methyl-2-oxo-6-[(1Z,3Z)-penta-1,3-dienyl]pyran-3-yl]methyl]chromen-2-one.
| Compound Name | 4-(4-bromophenyl)sulfanyl-3-[[4-[(2E,4Z)-4,5-dimethylhepta-2,4,6-trien-2-yl]sulfanyl-5-methyl-2-oxo-6-[(1Z,3Z)-penta-1,3-dienyl]pyran-3-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 142831685 |
| Molecular Formula | C36H33BrO4S2 |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | 4-(4-bromophenyl)sulfanyl-3-[[4-[(2E,4Z)-4,5-dimethylhepta-2,4,6-trien-2-yl]sulfanyl-5-methyl-2-oxo-6-[(1Z,3Z)-penta-1,3-dienyl]pyran-3-yl]methyl]chromen-2-one |
| SMILES | C=C/C(C)=C(C)\C=C(/C)Sc1c(C)c(/C=C\C=C/C)oc(=O)c1Cc1c(Sc2ccc(Br)cc2)c2ccccc2oc1=O |
| InChI | InChI=1S/C36H33BrO4S2/c1-7-9-10-14-31-25(6)33(42-24(5)20-23(4)22(3)8-2)29(35(38)40-31)21-30-34(43-27-18-16-26(37)17-19-27)28-13-11-12-15-32(28)41-36(30)39/h7-20H,2,21H2,1,3-6H3/b9-7-,14-10-,23-22-,24-20+ |
| InChIKey | ZJROJRQZISURNN-PPJDRVEUSA-N |
| XLogP | 10.67 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|