About N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane
N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane (PubChem CID 142831769) has the molecular formula C17H23F3N2O
and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane.
Molecular Properties
| Compound Name | N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane |
| PubChem CID | 142831769 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane |
| SMILES | CC.CC.O=C(NCC1=c2ccncc2=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O.2C2H6/c14-13(15,16)12(19)18-8-10-4-2-1-3-9-7-17-6-5-11(9)10;2*1-2/h1-3,5-7H,4,8H2,(H,18,19);2*1-2H3 |
| InChIKey | GCWFTOCGALUKLU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane?
The IUPAC name of N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane (CID 142831769) is N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane.
What is the SMILES notation for N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane?
The canonical SMILES for N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane is CC.CC.O=C(NCC1=c2ccncc2=CC=CC1)C(F)(F)F.
What is the InChIKey of N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane?
The InChIKey is GCWFTOCGALUKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O.2C2H6/c14-13(15,16)12(19)18-8-10-4-2-1-3-9-7-17-6-5-11(9)10;2*1-2/h1-3,5-7H,4,8H2,(H,18,19);2*1-2H3.
What are the key properties of N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane?
N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane has a molecular weight of 328.38 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6H-cyclohepta[c]pyridin-5-ylmethyl)-2,2,2-trifluoroacetamide;ethane is sourced from PubChem (CID 142831769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).