C19H24O6 — CID 142831876
7-methoxy-4-(3,4,4-trimethoxycyclohexa-1,5-dien-1-yl)-3,4-dihydro-2H-chromen-2-ol (PubChem CID 142831876) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 7-methoxy-4-(3,4,4-trimethoxycyclohexa-1,5-dien-1-yl)-3,4-dihydro-2H-chromen-2-ol.
| Compound Name | 7-methoxy-4-(3,4,4-trimethoxycyclohexa-1,5-dien-1-yl)-3,4-dihydro-2H-chromen-2-ol |
|---|---|
| PubChem CID | 142831876 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 7-methoxy-4-(3,4,4-trimethoxycyclohexa-1,5-dien-1-yl)-3,4-dihydro-2H-chromen-2-ol |
| SMILES | COc1ccc2c(c1)OC(O)CC2C1=CC(OC)C(OC)(OC)C=C1 |
| InChI | InChI=1S/C19H24O6/c1-21-13-5-6-14-15(11-18(20)25-16(14)10-13)12-7-8-19(23-3,24-4)17(9-12)22-2/h5-10,15,17-18,20H,11H2,1-4H3 |
| InChIKey | ROJQFCIQRLFQNP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|