C17H10ClNS2 — CID 142832412
9-chloro-4-ethenyl-3,12-dithia-5-azatetracyclo[9.7.0.02,7.013,18]octadeca-1,4,6,8,10,13,15,17-octaene (PubChem CID 142832412) has the molecular formula C17H10ClNS2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 9-chloro-4-ethenyl-3,12-dithia-5-azatetracyclo[9.7.0.02,7.013,18]octadeca-1,4,6,8,10,13,15,17-octaene.
| Compound Name | 9-chloro-4-ethenyl-3,12-dithia-5-azatetracyclo[9.7.0.02,7.013,18]octadeca-1,4,6,8,10,13,15,17-octaene |
|---|---|
| PubChem CID | 142832412 |
| Molecular Formula | C17H10ClNS2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 9-chloro-4-ethenyl-3,12-dithia-5-azatetracyclo[9.7.0.02,7.013,18]octadeca-1,4,6,8,10,13,15,17-octaene |
| SMILES | C=CC1=NC=C2C=C(Cl)C=c3sc4ccccc4c3=C2S1 |
| InChI | InChI=1S/C17H10ClNS2/c1-2-15-19-9-10-7-11(18)8-14-16(17(10)21-15)12-5-3-4-6-13(12)20-14/h2-9H,1H2 |
| InChIKey | RLMYDNLCYONZAE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |