About 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide
1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide (PubChem CID 142832976) has the molecular formula C16H22N2OS
and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide.
Molecular Properties
| Compound Name | 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide |
| PubChem CID | 142832976 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide |
| SMILES | CCC(C)(C)c1ccc(C)cc1.O=CNc1nccs1 |
| InChI | InChI=1S/C12H18.C4H4N2OS/c1-5-12(3,4)11-8-6-10(2)7-9-11;7-3-6-4-5-1-2-8-4/h6-9H,5H2,1-4H3;1-3H,(H,5,6,7) |
| InChIKey | VTMPNEFBYILJPR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide?
The IUPAC name of 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide (CID 142832976) is 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide.
What is the SMILES notation for 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide?
The canonical SMILES for 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide is CCC(C)(C)c1ccc(C)cc1.O=CNc1nccs1.
What is the InChIKey of 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide?
The InChIKey is VTMPNEFBYILJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C4H4N2OS/c1-5-12(3,4)11-8-6-10(2)7-9-11;7-3-6-4-5-1-2-8-4/h6-9H,5H2,1-4H3;1-3H,(H,5,6,7).
What are the key properties of 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide?
1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide has a molecular weight of 290.43 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(2-methylbutan-2-yl)benzene;N-(1,3-thiazol-2-yl)formamide is sourced from PubChem (CID 142832976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).