C19H34N2O — CID 142833066
ethane;2-[methyl-[1-(4-methylphenyl)cyclopentyl]amino]acetamide (PubChem CID 142833066) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is ethane;2-[methyl-[1-(4-methylphenyl)cyclopentyl]amino]acetamide.
| Compound Name | ethane;2-[methyl-[1-(4-methylphenyl)cyclopentyl]amino]acetamide |
|---|---|
| PubChem CID | 142833066 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | ethane;2-[methyl-[1-(4-methylphenyl)cyclopentyl]amino]acetamide |
| SMILES | CC.CC.Cc1ccc(C2(N(C)CC(N)=O)CCCC2)cc1 |
| InChI | InChI=1S/C15H22N2O.2C2H6/c1-12-5-7-13(8-6-12)15(9-3-4-10-15)17(2)11-14(16)18;2*1-2/h5-8H,3-4,9-11H2,1-2H3,(H2,16,18);2*1-2H3 |
| InChIKey | WUXBITHSIYMXIM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |