About 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene
4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene (PubChem CID 142833104) has the molecular formula C12H12ClF
and a molecular weight of 210.68 g/mol. Its IUPAC name is 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene.
Analyze 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene?
The IUPAC name of 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene (CID 142833104) is 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene.
What is the SMILES notation for 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene?
The canonical SMILES for 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene is Cc1cc2c(cc1F)CC(C)C=C2Cl.
What is the InChIKey of 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene?
The InChIKey is ZMFJWRDYCDYGCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClF/c1-7-3-9-6-12(14)8(2)5-10(9)11(13)4-7/h4-7H,3H2,1-2H3.
What are the key properties of 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene?
4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene has a molecular weight of 210.68 g/mol, XLogP of 3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-fluoro-2,6-dimethyl-1,2-dihydronaphthalene is sourced from PubChem (CID 142833104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).