C18H26FN3O4 — CID 142833416
(2R)-2-[[(2S)-1-[2-[(2-cyclopropylacetyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoyl fluoride (PubChem CID 142833416) has the molecular formula C18H26FN3O4 and a molecular weight of 367.42 g/mol. Its IUPAC name is (2R)-2-[[(2S)-1-[2-[(2-cyclopropylacetyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoyl fluoride.
| Compound Name | (2R)-2-[[(2S)-1-[2-[(2-cyclopropylacetyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoyl fluoride |
|---|---|
| PubChem CID | 142833416 |
| Molecular Formula | C18H26FN3O4 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (2R)-2-[[(2S)-1-[2-[(2-cyclopropylacetyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-3-methylpent-4-enoyl fluoride |
| SMILES | C=CC(C)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)CC1CC1)C(=O)F |
| InChI | InChI=1S/C18H26FN3O4/c1-3-11(2)16(17(19)25)21-18(26)13-5-4-8-22(13)15(24)10-20-14(23)9-12-6-7-12/h3,11-13,16H,1,4-10H2,2H3,(H,20,23)(H,21,26)/t11?,13-,16+/m0/s1 |
| InChIKey | QAQASIDHTPLQFX-GRLMSTMOSA-N |
| XLogP | 0.70 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|