C25H44 — CID 142833950
(3R,7S)-5-(cyclohexen-1-yl)-1,7-dimethyl-3-[(Z)-oct-3-enyl]cycloheptene;ethane (PubChem CID 142833950) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is (3R,7S)-5-(cyclohexen-1-yl)-1,7-dimethyl-3-[(Z)-oct-3-enyl]cycloheptene;ethane.
| Compound Name | (3R,7S)-5-(cyclohexen-1-yl)-1,7-dimethyl-3-[(Z)-oct-3-enyl]cycloheptene;ethane |
|---|---|
| PubChem CID | 142833950 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | (3R,7S)-5-(cyclohexen-1-yl)-1,7-dimethyl-3-[(Z)-oct-3-enyl]cycloheptene;ethane |
| SMILES | CC.CCCC/C=C\CC[C@H]1C=C(C)[C@@H](C)CC(C2=CCCCC2)C1 |
| InChI | InChI=1S/C23H38.C2H6/c1-4-5-6-7-8-10-13-21-16-19(2)20(3)17-23(18-21)22-14-11-9-12-15-22;1-2/h7-8,14,16,20-21,23H,4-6,9-13,15,17-18H2,1-3H3;1-2H3/b8-7-;/t20-,21-,23?;/m0./s1 |
| InChIKey | NORDPAWGTAGSLM-NFFKVJFYSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|