About (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene
(3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene (PubChem CID 142834097) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene.
Molecular Properties
| Compound Name | (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene |
| PubChem CID | 142834097 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene |
| SMILES | C/C=C\C=C1\CCCCNC1.C=C(C)CC |
| InChI | InChI=1S/C10H17N.C5H10/c1-2-3-6-10-7-4-5-8-11-9-10;1-4-5(2)3/h2-3,6,11H,4-5,7-9H2,1H3;2,4H2,1,3H3/b3-2-,10-6-; |
| InChIKey | XCEWKSUIZKOFHO-VKPVDJRPSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene?
The IUPAC name of (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene (CID 142834097) is (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene.
What is the SMILES notation for (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene?
The canonical SMILES for (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene is C/C=C\C=C1\CCCCNC1.C=C(C)CC.
What is the InChIKey of (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene?
The InChIKey is XCEWKSUIZKOFHO-VKPVDJRPSA-N. The full InChI is InChI=1S/C10H17N.C5H10/c1-2-3-6-10-7-4-5-8-11-9-10;1-4-5(2)3/h2-3,6,11H,4-5,7-9H2,1H3;2,4H2,1,3H3/b3-2-,10-6-;.
What are the key properties of (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene?
(3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene has a molecular weight of 221.39 g/mol, XLogP of 4.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(Z)-but-2-enylidene]azepane;2-methylbut-1-ene is sourced from PubChem (CID 142834097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).