C25H33NO2 — CID 142834136
(E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine (PubChem CID 142834136) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine.
| Compound Name | (E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine |
|---|---|
| PubChem CID | 142834136 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (E,2R)-N-[[3-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-4-prop-2-ynoxycyclohepta-1,3,5-trien-1-yl]methyl]-3-methylpent-3-en-2-amine |
| SMILES | C#CCOC1=C(/C(C)=C/C=C(\C=C)OC)C=C(CN[C@H](C)/C(C)=C/C)CC=C1 |
| InChI | InChI=1S/C25H33NO2/c1-8-16-28-25-13-11-12-22(18-26-21(6)19(4)9-2)17-24(25)20(5)14-15-23(10-3)27-7/h1,9-11,13-15,17,21,26H,3,12,16,18H2,2,4-7H3/b19-9+,20-14+,23-15+/t21-/m1/s1 |
| InChIKey | NLAWEFJJCOSROF-CAGADYATSA-N |
| XLogP | 5.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|